C11H15N3OS — CID 43728977
1-(2-methoxyethyl)-N-(thiophen-2-ylmethyl)pyrazol-4-amine (PubChem CID 43728977) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 1-(2-methoxyethyl)-N-(thiophen-2-ylmethyl)pyrazol-4-amine.
| Compound Name | 1-(2-methoxyethyl)-N-(thiophen-2-ylmethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 43728977 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 1-(2-methoxyethyl)-N-(thiophen-2-ylmethyl)pyrazol-4-amine |
| SMILES | COCCn1cc(NCc2cccs2)cn1 |
| InChI | InChI=1S/C11H15N3OS/c1-15-5-4-14-9-10(7-13-14)12-8-11-3-2-6-16-11/h2-3,6-7,9,12H,4-5,8H2,1H3 |
| InChIKey | LUHAJXSOUHKLGU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |