C9H18N2O2 — CID 12696599
1-cyclohexyl-3-(1,1-dideuterio-2-hydroxyethyl)urea (PubChem CID 12696599) has the molecular formula C9H18N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-cyclohexyl-3-(1,1-dideuterio-2-hydroxyethyl)urea.
| Compound Name | 1-cyclohexyl-3-(1,1-dideuterio-2-hydroxyethyl)urea |
|---|---|
| PubChem CID | 12696599 |
| Molecular Formula | C9H18N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 1-cyclohexyl-3-(1,1-dideuterio-2-hydroxyethyl)urea |
| SMILES | [2H]C([2H])(CO)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C9H18N2O2/c12-7-6-10-9(13)11-8-4-2-1-3-5-8/h8,12H,1-7H2,(H2,10,11,13)/i6D2 |
| InChIKey | MJBAEQKACQBEMK-NCYHJHSESA-N |
| XLogP | 0.61 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |