C11H22N2O3 — CID 853062
1-cyclohexyl-3-(1,3-dihydroxy-2-methylpropan-2-yl)urea (PubChem CID 853062) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is 1-cyclohexyl-3-(1,3-dihydroxy-2-methylpropan-2-yl)urea.
| Compound Name | 1-cyclohexyl-3-(1,3-dihydroxy-2-methylpropan-2-yl)urea |
|---|---|
| PubChem CID | 853062 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | 1-cyclohexyl-3-(1,3-dihydroxy-2-methylpropan-2-yl)urea |
| SMILES | CC(CO)(CO)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C11H22N2O3/c1-11(7-14,8-15)13-10(16)12-9-5-3-2-4-6-9/h9,14-15H,2-8H2,1H3,(H2,12,13,16) |
| InChIKey | DLFWNESJEVODFU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |