C14H20ClN3O — CID 126966507
3-[[(1-propan-2-ylpyrazol-3-yl)methylamino]methyl]phenol;hydrochloride (PubChem CID 126966507) has the molecular formula C14H20ClN3O and a molecular weight of 281.79 g/mol. Its IUPAC name is 3-[[(1-propan-2-ylpyrazol-3-yl)methylamino]methyl]phenol;hydrochloride.
| Compound Name | 3-[[(1-propan-2-ylpyrazol-3-yl)methylamino]methyl]phenol;hydrochloride |
|---|---|
| PubChem CID | 126966507 |
| Molecular Formula | C14H20ClN3O |
| Molecular Weight | 281.79 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 3-[[(1-propan-2-ylpyrazol-3-yl)methylamino]methyl]phenol;hydrochloride |
| SMILES | CC(C)n1ccc(CNCc2cccc(O)c2)n1.Cl |
| InChI | InChI=1S/C14H19N3O.ClH/c1-11(2)17-7-6-13(16-17)10-15-9-12-4-3-5-14(18)8-12;/h3-8,11,15,18H,9-10H2,1-2H3;1H |
| InChIKey | WCRDEMVPCPULTO-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.79 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |