C14H30Cl2N4 — CID 126966604
N',N'-diethyl-N-[(3-methyl-1-propan-2-ylpyrazol-4-yl)methyl]ethane-1,2-diamine;dihydrochloride (PubChem CID 126966604) has the molecular formula C14H30Cl2N4 and a molecular weight of 325.33 g/mol. Its IUPAC name is N',N'-diethyl-N-[(3-methyl-1-propan-2-ylpyrazol-4-yl)methyl]ethane-1,2-diamine;dihydrochloride.
| Compound Name | N',N'-diethyl-N-[(3-methyl-1-propan-2-ylpyrazol-4-yl)methyl]ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 126966604 |
| Molecular Formula | C14H30Cl2N4 |
| Molecular Weight | 325.33 g/mol |
| Exact Mass | 324.18 |
| IUPAC Name | N',N'-diethyl-N-[(3-methyl-1-propan-2-ylpyrazol-4-yl)methyl]ethane-1,2-diamine;dihydrochloride |
| SMILES | CCN(CC)CCNCc1cn(C(C)C)nc1C.Cl.Cl |
| InChI | InChI=1S/C14H28N4.2ClH/c1-6-17(7-2)9-8-15-10-14-11-18(12(3)4)16-13(14)5;;/h11-12,15H,6-10H2,1-5H3;2*1H |
| InChIKey | RBYCRCPSOCTSMU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 33.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|