C9H16N2S — CID 126971076
N-ethyl-4-methyl-5-propan-2-yl-1,3-thiazol-2-amine (PubChem CID 126971076) has the molecular formula C9H16N2S and a molecular weight of 184.31 g/mol. Its IUPAC name is N-ethyl-4-methyl-5-propan-2-yl-1,3-thiazol-2-amine.
| Compound Name | N-ethyl-4-methyl-5-propan-2-yl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 126971076 |
| Molecular Formula | C9H16N2S |
| Molecular Weight | 184.31 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | N-ethyl-4-methyl-5-propan-2-yl-1,3-thiazol-2-amine |
| SMILES | CCNc1nc(C)c(C(C)C)s1 |
| InChI | InChI=1S/C9H16N2S/c1-5-10-9-11-7(4)8(12-9)6(2)3/h6H,5H2,1-4H3,(H,10,11) |
| InChIKey | GBHQFRYSCVTJTR-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |