C10H19NO — CID 126975139
2,3-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]piperidine (PubChem CID 126975139) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is 2,3-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]piperidine.
| Compound Name | 2,3-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]piperidine |
|---|---|
| PubChem CID | 126975139 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | 2,3-dimethyl-1-[[(2R)-oxiran-2-yl]methyl]piperidine |
| SMILES | CC1CCCN(C[C@@H]2CO2)C1C |
| InChI | InChI=1S/C10H19NO/c1-8-4-3-5-11(9(8)2)6-10-7-12-10/h8-10H,3-7H2,1-2H3/t8?,9?,10-/m1/s1 |
| InChIKey | XLMSHIILYQCZHE-UDNWOFFPSA-N |
| XLogP | 1.51 |
| TPSA | 15.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|