About 1-[(2,3-dimethylpiperidin-1-yl)methyl]cyclopropan-1-amine
1-[(2,3-dimethylpiperidin-1-yl)methyl]cyclopropan-1-amine (PubChem CID 65457048) has the molecular formula C11H22N2
and a molecular weight of 182.31 g/mol. Its IUPAC name is 1-[(2,3-dimethylpiperidin-1-yl)methyl]cyclopropan-1-amine.
Molecular Properties
| Compound Name | 1-[(2,3-dimethylpiperidin-1-yl)methyl]cyclopropan-1-amine |
| PubChem CID | 65457048 |
| Molecular Formula | C11H22N2 |
| Molecular Weight | 182.31 g/mol |
| Exact Mass | 182.18 |
| IUPAC Name | 1-[(2,3-dimethylpiperidin-1-yl)methyl]cyclopropan-1-amine |
| SMILES | CC1CCCN(CC2(N)CC2)C1C |
| InChI | InChI=1S/C11H22N2/c1-9-4-3-7-13(10(9)2)8-11(12)5-6-11/h9-10H,3-8,12H2,1-2H3 |
| InChIKey | KRUKLFJQPPDQTE-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.31 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2,3-dimethylpiperidin-1-yl)methyl]cyclopropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,3-dimethylpiperidin-1-yl)methyl]cyclopropan-1-amine?
The IUPAC name of 1-[(2,3-dimethylpiperidin-1-yl)methyl]cyclopropan-1-amine (CID 65457048) is 1-[(2,3-dimethylpiperidin-1-yl)methyl]cyclopropan-1-amine.
What is the SMILES notation for 1-[(2,3-dimethylpiperidin-1-yl)methyl]cyclopropan-1-amine?
The canonical SMILES for 1-[(2,3-dimethylpiperidin-1-yl)methyl]cyclopropan-1-amine is CC1CCCN(CC2(N)CC2)C1C.
What is the InChIKey of 1-[(2,3-dimethylpiperidin-1-yl)methyl]cyclopropan-1-amine?
The InChIKey is KRUKLFJQPPDQTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2/c1-9-4-3-7-13(10(9)2)8-11(12)5-6-11/h9-10H,3-8,12H2,1-2H3.
What are the key properties of 1-[(2,3-dimethylpiperidin-1-yl)methyl]cyclopropan-1-amine?
1-[(2,3-dimethylpiperidin-1-yl)methyl]cyclopropan-1-amine has a molecular weight of 182.31 g/mol, XLogP of 1.60, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,3-dimethylpiperidin-1-yl)methyl]cyclopropan-1-amine is sourced from PubChem (CID 65457048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).