C13H24N2 — CID 65459564
1-[(2-cyclopentylpyrrolidin-1-yl)methyl]cyclopropan-1-amine (PubChem CID 65459564) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is 1-[(2-cyclopentylpyrrolidin-1-yl)methyl]cyclopropan-1-amine.
| Compound Name | 1-[(2-cyclopentylpyrrolidin-1-yl)methyl]cyclopropan-1-amine |
|---|---|
| PubChem CID | 65459564 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | 1-[(2-cyclopentylpyrrolidin-1-yl)methyl]cyclopropan-1-amine |
| SMILES | NC1(CN2CCCC2C2CCCC2)CC1 |
| InChI | InChI=1S/C13H24N2/c14-13(7-8-13)10-15-9-3-6-12(15)11-4-1-2-5-11/h11-12H,1-10,14H2 |
| InChIKey | HPKIPEXAWZDECR-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |