C18H33NO — CID 102728342
[1-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]cycloheptyl]methanol (PubChem CID 102728342) has the molecular formula C18H33NO and a molecular weight of 279.47 g/mol. Its IUPAC name is [1-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]cycloheptyl]methanol.
| Compound Name | [1-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]cycloheptyl]methanol |
|---|---|
| PubChem CID | 102728342 |
| Molecular Formula | C18H33NO |
| Molecular Weight | 279.47 g/mol |
| Exact Mass | 279.26 |
| IUPAC Name | [1-[[(4aR,8aR)-3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl]methyl]cycloheptyl]methanol |
| SMILES | OCC1(CN2CCC[C@H]3CCCC[C@H]32)CCCCCC1 |
| InChI | InChI=1S/C18H33NO/c20-15-18(11-5-1-2-6-12-18)14-19-13-7-9-16-8-3-4-10-17(16)19/h16-17,20H,1-15H2/t16-,17-/m1/s1 |
| InChIKey | HTGMLOUMJABIKB-IAGOWNOFSA-N |
| XLogP | 3.97 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |