C17H30BrN — CID 65319651
1-[[1-(bromomethyl)cycloheptyl]methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine (PubChem CID 65319651) has the molecular formula C17H30BrN and a molecular weight of 328.34 g/mol. Its IUPAC name is 1-[[1-(bromomethyl)cycloheptyl]methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine.
| Compound Name | 1-[[1-(bromomethyl)cycloheptyl]methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine |
|---|---|
| PubChem CID | 65319651 |
| Molecular Formula | C17H30BrN |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 327.16 |
| IUPAC Name | 1-[[1-(bromomethyl)cycloheptyl]methyl]-2,3,4,4a,5,6,7,7a-octahydrocyclopenta[b]pyridine |
| SMILES | BrCC1(CN2CCCC3CCCC32)CCCCCC1 |
| InChI | InChI=1S/C17H30BrN/c18-13-17(10-3-1-2-4-11-17)14-19-12-6-8-15-7-5-9-16(15)19/h15-16H,1-14H2 |
| InChIKey | GPRACCOXTPSHKV-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|