C14H26N2 — CID 115453680
[1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)cyclopropyl]methanamine (PubChem CID 115453680) has the molecular formula C14H26N2 and a molecular weight of 222.38 g/mol. Its IUPAC name is [1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)cyclopropyl]methanamine.
| Compound Name | [1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)cyclopropyl]methanamine |
|---|---|
| PubChem CID | 115453680 |
| Molecular Formula | C14H26N2 |
| Molecular Weight | 222.38 g/mol |
| Exact Mass | 222.21 |
| IUPAC Name | [1-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-ylmethyl)cyclopropyl]methanamine |
| SMILES | NCC1(CN2CCCC3CCCCC32)CC1 |
| InChI | InChI=1S/C14H26N2/c15-10-14(7-8-14)11-16-9-3-5-12-4-1-2-6-13(12)16/h12-13H,1-11,15H2 |
| InChIKey | RAKHIHNZGQNQDL-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |