C15H28N2O — CID 82749737
[4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylmethyl)oxan-4-yl]methanamine (PubChem CID 82749737) has the molecular formula C15H28N2O and a molecular weight of 252.40 g/mol. Its IUPAC name is [4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylmethyl)oxan-4-yl]methanamine.
| Compound Name | [4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylmethyl)oxan-4-yl]methanamine |
|---|---|
| PubChem CID | 82749737 |
| Molecular Formula | C15H28N2O |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.22 |
| IUPAC Name | [4-(2,3,3a,4,5,6,7,7a-octahydroindol-1-ylmethyl)oxan-4-yl]methanamine |
| SMILES | NCC1(CN2CCC3CCCCC32)CCOCC1 |
| InChI | InChI=1S/C15H28N2O/c16-11-15(6-9-18-10-7-15)12-17-8-5-13-3-1-2-4-14(13)17/h13-14H,1-12,16H2 |
| InChIKey | ANBFEDQVNNYERC-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |