C9H8N2OS — CID 126975818
2-(4-methyl-3-pyridinyl)-1,3-thiazol-4-one (PubChem CID 126975818) has the molecular formula C9H8N2OS and a molecular weight of 192.24 g/mol. Its IUPAC name is 2-(4-methyl-3-pyridinyl)-1,3-thiazol-4-one.
| Compound Name | 2-(4-methyl-3-pyridinyl)-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 126975818 |
| Molecular Formula | C9H8N2OS |
| Molecular Weight | 192.24 g/mol |
| Exact Mass | 192.04 |
| IUPAC Name | 2-(4-methyl-3-pyridinyl)-1,3-thiazol-4-one |
| SMILES | Cc1ccncc1C1=NC(=O)CS1 |
| InChI | InChI=1S/C9H8N2OS/c1-6-2-3-10-4-7(6)9-11-8(12)5-13-9/h2-4H,5H2,1H3 |
| InChIKey | VIIAPLPYZRJUOY-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 42.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.24 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |