C9H12O3S — CID 126981802
6-thiophen-3-yl-1,4-dioxepan-6-ol (PubChem CID 126981802) has the molecular formula C9H12O3S and a molecular weight of 200.26 g/mol. Its IUPAC name is 6-thiophen-3-yl-1,4-dioxepan-6-ol.
| Compound Name | 6-thiophen-3-yl-1,4-dioxepan-6-ol |
|---|---|
| PubChem CID | 126981802 |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 6-thiophen-3-yl-1,4-dioxepan-6-ol |
| SMILES | OC1(c2ccsc2)COCCOC1 |
| InChI | InChI=1S/C9H12O3S/c10-9(8-1-4-13-5-8)6-11-2-3-12-7-9/h1,4-5,10H,2-3,6-7H2 |
| InChIKey | AKGDITTWPVWALU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |