About 6-thiophen-3-yl-1,4-dioxepan-6-ol
6-thiophen-3-yl-1,4-dioxepan-6-ol (PubChem CID 126981802) has the molecular formula C9H12O3S
and a molecular weight of 200.26 g/mol. Its IUPAC name is 6-thiophen-3-yl-1,4-dioxepan-6-ol.
Molecular Properties
| Compound Name | 6-thiophen-3-yl-1,4-dioxepan-6-ol |
| PubChem CID | 126981802 |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | 6-thiophen-3-yl-1,4-dioxepan-6-ol |
| SMILES | OC1(c2ccsc2)COCCOC1 |
| InChI | InChI=1S/C9H12O3S/c10-9(8-1-4-13-5-8)6-11-2-3-12-7-9/h1,4-5,10H,2-3,6-7H2 |
| InChIKey | AKGDITTWPVWALU-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-thiophen-3-yl-1,4-dioxepan-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-thiophen-3-yl-1,4-dioxepan-6-ol?
The IUPAC name of 6-thiophen-3-yl-1,4-dioxepan-6-ol (CID 126981802) is 6-thiophen-3-yl-1,4-dioxepan-6-ol.
What is the SMILES notation for 6-thiophen-3-yl-1,4-dioxepan-6-ol?
The canonical SMILES for 6-thiophen-3-yl-1,4-dioxepan-6-ol is OC1(c2ccsc2)COCCOC1.
What is the InChIKey of 6-thiophen-3-yl-1,4-dioxepan-6-ol?
The InChIKey is AKGDITTWPVWALU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3S/c10-9(8-1-4-13-5-8)6-11-2-3-12-7-9/h1,4-5,10H,2-3,6-7H2.
What are the key properties of 6-thiophen-3-yl-1,4-dioxepan-6-ol?
6-thiophen-3-yl-1,4-dioxepan-6-ol has a molecular weight of 200.26 g/mol, XLogP of 0.98, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-thiophen-3-yl-1,4-dioxepan-6-ol is sourced from PubChem (CID 126981802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).