C10H14Br2N2 — CID 126982948
3-N-(2,4-dibromophenyl)butane-2,3-diamine (PubChem CID 126982948) has the molecular formula C10H14Br2N2 and a molecular weight of 322.04 g/mol. Its IUPAC name is 3-N-(2,4-dibromophenyl)butane-2,3-diamine.
| Compound Name | 3-N-(2,4-dibromophenyl)butane-2,3-diamine |
|---|---|
| PubChem CID | 126982948 |
| Molecular Formula | C10H14Br2N2 |
| Molecular Weight | 322.04 g/mol |
| Exact Mass | 319.95 |
| IUPAC Name | 3-N-(2,4-dibromophenyl)butane-2,3-diamine |
| SMILES | CC(N)C(C)Nc1ccc(Br)cc1Br |
| InChI | InChI=1S/C10H14Br2N2/c1-6(13)7(2)14-10-4-3-8(11)5-9(10)12/h3-7,14H,13H2,1-2H3 |
| InChIKey | FBSBBKJBSSGLSP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.04 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |