C14H12Br2IN — CID 43780861
2,4-dibromo-N-[1-(4-iodophenyl)ethyl]aniline (PubChem CID 43780861) has the molecular formula C14H12Br2IN and a molecular weight of 480.97 g/mol. Its IUPAC name is 2,4-dibromo-N-[1-(4-iodophenyl)ethyl]aniline.
| Compound Name | 2,4-dibromo-N-[1-(4-iodophenyl)ethyl]aniline |
|---|---|
| PubChem CID | 43780861 |
| Molecular Formula | C14H12Br2IN |
| Molecular Weight | 480.97 g/mol |
| Exact Mass | 478.84 |
| IUPAC Name | 2,4-dibromo-N-[1-(4-iodophenyl)ethyl]aniline |
| SMILES | CC(Nc1ccc(Br)cc1Br)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H12Br2IN/c1-9(10-2-5-12(17)6-3-10)18-14-7-4-11(15)8-13(14)16/h2-9,18H,1H3 |
| InChIKey | MLEJJZWZHANCQL-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.97 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|