C8H18N2 — CID 126985336
1,1-dimethyl-2-[(1-methylcyclobutyl)methyl]hydrazine (PubChem CID 126985336) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 1,1-dimethyl-2-[(1-methylcyclobutyl)methyl]hydrazine.
| Compound Name | 1,1-dimethyl-2-[(1-methylcyclobutyl)methyl]hydrazine |
|---|---|
| PubChem CID | 126985336 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 1,1-dimethyl-2-[(1-methylcyclobutyl)methyl]hydrazine |
| SMILES | CN(C)NCC1(C)CCC1 |
| InChI | InChI=1S/C8H18N2/c1-8(5-4-6-8)7-9-10(2)3/h9H,4-7H2,1-3H3 |
| InChIKey | AGIWIDVFBSZRDU-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|