C10H12N4 — CID 126988363
6-(cyclopentylamino)pyridazine-3-carbonitrile (PubChem CID 126988363) has the molecular formula C10H12N4 and a molecular weight of 188.23 g/mol. Its IUPAC name is 6-(cyclopentylamino)pyridazine-3-carbonitrile.
| Compound Name | 6-(cyclopentylamino)pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 126988363 |
| Molecular Formula | C10H12N4 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.11 |
| IUPAC Name | 6-(cyclopentylamino)pyridazine-3-carbonitrile |
| SMILES | N#Cc1ccc(NC2CCCC2)nn1 |
| InChI | InChI=1S/C10H12N4/c11-7-9-5-6-10(14-13-9)12-8-3-1-2-4-8/h5-6,8H,1-4H2,(H,12,14) |
| InChIKey | LOPGWWKQMHNOIP-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |