C17H16F3N5 — CID 24989201
6-[[1-[(3,4,5-trifluorophenyl)methyl]piperidin-4-yl]amino]pyridazine-3-carbonitrile (PubChem CID 24989201) has the molecular formula C17H16F3N5 and a molecular weight of 347.34 g/mol. Its IUPAC name is 6-[[1-[(3,4,5-trifluorophenyl)methyl]piperidin-4-yl]amino]pyridazine-3-carbonitrile.
| Compound Name | 6-[[1-[(3,4,5-trifluorophenyl)methyl]piperidin-4-yl]amino]pyridazine-3-carbonitrile |
|---|---|
| PubChem CID | 24989201 |
| Molecular Formula | C17H16F3N5 |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 6-[[1-[(3,4,5-trifluorophenyl)methyl]piperidin-4-yl]amino]pyridazine-3-carbonitrile |
| SMILES | N#Cc1ccc(NC2CCN(Cc3cc(F)c(F)c(F)c3)CC2)nn1 |
| InChI | InChI=1S/C17H16F3N5/c18-14-7-11(8-15(19)17(14)20)10-25-5-3-12(4-6-25)22-16-2-1-13(9-21)23-24-16/h1-2,7-8,12H,3-6,10H2,(H,22,24) |
| InChIKey | DWKILCRFXLZMLJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|