C17H18FN5 — CID 154779916
2-fluoro-5-[[4-(pyridazin-3-ylamino)piperidin-1-yl]methyl]benzonitrile (PubChem CID 154779916) has the molecular formula C17H18FN5 and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-fluoro-5-[[4-(pyridazin-3-ylamino)piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 2-fluoro-5-[[4-(pyridazin-3-ylamino)piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 154779916 |
| Molecular Formula | C17H18FN5 |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-fluoro-5-[[4-(pyridazin-3-ylamino)piperidin-1-yl]methyl]benzonitrile |
| SMILES | N#Cc1cc(CN2CCC(Nc3cccnn3)CC2)ccc1F |
| InChI | InChI=1S/C17H18FN5/c18-16-4-3-13(10-14(16)11-19)12-23-8-5-15(6-9-23)21-17-2-1-7-20-22-17/h1-4,7,10,15H,5-6,8-9,12H2,(H,21,22) |
| InChIKey | VCRXCUGEPZYHIR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 64.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |