C18H21FN4 — CID 175791551
(3aR,6aS)-2-[(3-fluorophenyl)methyl]-N-pyridazin-3-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 175791551) has the molecular formula C18H21FN4 and a molecular weight of 312.39 g/mol. Its IUPAC name is (3aR,6aS)-2-[(3-fluorophenyl)methyl]-N-pyridazin-3-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aR,6aS)-2-[(3-fluorophenyl)methyl]-N-pyridazin-3-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 175791551 |
| Molecular Formula | C18H21FN4 |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (3aR,6aS)-2-[(3-fluorophenyl)methyl]-N-pyridazin-3-yl-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | Fc1cccc(CN2C[C@H]3CC(Nc4cccnn4)C[C@H]3C2)c1 |
| InChI | InChI=1S/C18H21FN4/c19-16-4-1-3-13(7-16)10-23-11-14-8-17(9-15(14)12-23)21-18-5-2-6-20-22-18/h1-7,14-15,17H,8-12H2,(H,21,22)/t14-,15+,17? |
| InChIKey | MNBXCQSUBZMNMJ-FKEKPDDDSA-N |
| XLogP | 2.94 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |