C24H24FN3 — CID 70273799
2-fluoro-5-[[4-[(2-methylquinolin-4-yl)methyl]piperidin-1-yl]methyl]benzonitrile (PubChem CID 70273799) has the molecular formula C24H24FN3 and a molecular weight of 373.48 g/mol. Its IUPAC name is 2-fluoro-5-[[4-[(2-methylquinolin-4-yl)methyl]piperidin-1-yl]methyl]benzonitrile.
| Compound Name | 2-fluoro-5-[[4-[(2-methylquinolin-4-yl)methyl]piperidin-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 70273799 |
| Molecular Formula | C24H24FN3 |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 2-fluoro-5-[[4-[(2-methylquinolin-4-yl)methyl]piperidin-1-yl]methyl]benzonitrile |
| SMILES | Cc1cc(CC2CCN(Cc3ccc(F)c(C#N)c3)CC2)c2ccccc2n1 |
| InChI | InChI=1S/C24H24FN3/c1-17-12-20(22-4-2-3-5-24(22)27-17)13-18-8-10-28(11-9-18)16-19-6-7-23(25)21(14-19)15-26/h2-7,12,14,18H,8-11,13,16H2,1H3 |
| InChIKey | UPSPHSLNJPNFBD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |