C8H12N2O2 — CID 126989856
N-ethyl-N,3-dimethyl-1,2-oxazole-5-carboxamide (PubChem CID 126989856) has the molecular formula C8H12N2O2 and a molecular weight of 168.20 g/mol. Its IUPAC name is N-ethyl-N,3-dimethyl-1,2-oxazole-5-carboxamide.
| Compound Name | N-ethyl-N,3-dimethyl-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 126989856 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | N-ethyl-N,3-dimethyl-1,2-oxazole-5-carboxamide |
| SMILES | CCN(C)C(=O)c1cc(C)no1 |
| InChI | InChI=1S/C8H12N2O2/c1-4-10(3)8(11)7-5-6(2)9-12-7/h5H,4H2,1-3H3 |
| InChIKey | HBMWMFDMUKPGMD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |