C10H18N2S — CID 126993683
1-(2,2-dimethylcyclopropyl)-3-(1-methylcyclopropyl)thiourea (PubChem CID 126993683) has the molecular formula C10H18N2S and a molecular weight of 198.33 g/mol. Its IUPAC name is 1-(2,2-dimethylcyclopropyl)-3-(1-methylcyclopropyl)thiourea.
| Compound Name | 1-(2,2-dimethylcyclopropyl)-3-(1-methylcyclopropyl)thiourea |
|---|---|
| PubChem CID | 126993683 |
| Molecular Formula | C10H18N2S |
| Molecular Weight | 198.33 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 1-(2,2-dimethylcyclopropyl)-3-(1-methylcyclopropyl)thiourea |
| SMILES | CC1(NC(=S)NC2CC2(C)C)CC1 |
| InChI | InChI=1S/C10H18N2S/c1-9(2)6-7(9)11-8(13)12-10(3)4-5-10/h7H,4-6H2,1-3H3,(H2,11,12,13) |
| InChIKey | ZKAOHAZYJTVWCQ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|