C10H16FNO — CID 126994060
N-(2,2-dimethylcyclopropyl)-2-fluoro-3-methylbut-2-enamide (PubChem CID 126994060) has the molecular formula C10H16FNO and a molecular weight of 185.24 g/mol. Its IUPAC name is N-(2,2-dimethylcyclopropyl)-2-fluoro-3-methylbut-2-enamide.
| Compound Name | N-(2,2-dimethylcyclopropyl)-2-fluoro-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 126994060 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | N-(2,2-dimethylcyclopropyl)-2-fluoro-3-methylbut-2-enamide |
| SMILES | CC(C)=C(F)C(=O)NC1CC1(C)C |
| InChI | InChI=1S/C10H16FNO/c1-6(2)8(11)9(13)12-7-5-10(7,3)4/h7H,5H2,1-4H3,(H,12,13) |
| InChIKey | NAKFGRDDCWZPSB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|