About 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine
1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine (PubChem CID 126994341) has the molecular formula C11H17N3
and a molecular weight of 191.28 g/mol. Its IUPAC name is 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine.
Molecular Properties
| Compound Name | 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine |
| PubChem CID | 126994341 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine |
| SMILES | CCc1cc(NC2CC(N)C2)ccn1 |
| InChI | InChI=1S/C11H17N3/c1-2-9-7-10(3-4-13-9)14-11-5-8(12)6-11/h3-4,7-8,11H,2,5-6,12H2,1H3,(H,13,14) |
| InChIKey | LMIXYOYYHRXZNF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine?
The IUPAC name of 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine (CID 126994341) is 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine.
What is the SMILES notation for 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine?
The canonical SMILES for 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine is CCc1cc(NC2CC(N)C2)ccn1.
What is the InChIKey of 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine?
The InChIKey is LMIXYOYYHRXZNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3/c1-2-9-7-10(3-4-13-9)14-11-5-8(12)6-11/h3-4,7-8,11H,2,5-6,12H2,1H3,(H,13,14).
What are the key properties of 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine?
1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine has a molecular weight of 191.28 g/mol, XLogP of 1.55, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine is sourced from PubChem (CID 126994341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).