C11H17N3 — CID 126994341
1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine (PubChem CID 126994341) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine.
| Compound Name | 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 126994341 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 1-N-(2-ethyl-4-pyridinyl)cyclobutane-1,3-diamine |
| SMILES | CCc1cc(NC2CC(N)C2)ccn1 |
| InChI | InChI=1S/C11H17N3/c1-2-9-7-10(3-4-13-9)14-11-5-8(12)6-11/h3-4,7-8,11H,2,5-6,12H2,1H3,(H,13,14) |
| InChIKey | LMIXYOYYHRXZNF-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |