C11H16N2S — CID 80559355
1-N-(3-methylsulfanylphenyl)cyclobutane-1,3-diamine (PubChem CID 80559355) has the molecular formula C11H16N2S and a molecular weight of 208.33 g/mol. Its IUPAC name is 1-N-(3-methylsulfanylphenyl)cyclobutane-1,3-diamine.
| Compound Name | 1-N-(3-methylsulfanylphenyl)cyclobutane-1,3-diamine |
|---|---|
| PubChem CID | 80559355 |
| Molecular Formula | C11H16N2S |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-N-(3-methylsulfanylphenyl)cyclobutane-1,3-diamine |
| SMILES | CSc1cccc(NC2CC(N)C2)c1 |
| InChI | InChI=1S/C11H16N2S/c1-14-11-4-2-3-9(7-11)13-10-5-8(12)6-10/h2-4,7-8,10,13H,5-6,12H2,1H3 |
| InChIKey | NMQTVUZXTYTERF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |