C9H14N2S — CID 126995565
5-methyl-2-(3-methylpyrrolidin-1-yl)-1,3-thiazole (PubChem CID 126995565) has the molecular formula C9H14N2S and a molecular weight of 182.29 g/mol. Its IUPAC name is 5-methyl-2-(3-methylpyrrolidin-1-yl)-1,3-thiazole.
| Compound Name | 5-methyl-2-(3-methylpyrrolidin-1-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 126995565 |
| Molecular Formula | C9H14N2S |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 5-methyl-2-(3-methylpyrrolidin-1-yl)-1,3-thiazole |
| SMILES | Cc1cnc(N2CCC(C)C2)s1 |
| InChI | InChI=1S/C9H14N2S/c1-7-3-4-11(6-7)9-10-5-8(2)12-9/h5,7H,3-4,6H2,1-2H3 |
| InChIKey | LIKUNRYJCUSOCC-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |