C12H18N2S — CID 166199646
2-(3-azabicyclo[3.3.1]nonan-3-yl)-5-methyl-1,3-thiazole (PubChem CID 166199646) has the molecular formula C12H18N2S and a molecular weight of 222.36 g/mol. Its IUPAC name is 2-(3-azabicyclo[3.3.1]nonan-3-yl)-5-methyl-1,3-thiazole.
| Compound Name | 2-(3-azabicyclo[3.3.1]nonan-3-yl)-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 166199646 |
| Molecular Formula | C12H18N2S |
| Molecular Weight | 222.36 g/mol |
| Exact Mass | 222.12 |
| IUPAC Name | 2-(3-azabicyclo[3.3.1]nonan-3-yl)-5-methyl-1,3-thiazole |
| SMILES | Cc1cnc(N2CC3CCCC(C3)C2)s1 |
| InChI | InChI=1S/C12H18N2S/c1-9-6-13-12(15-9)14-7-10-3-2-4-11(5-10)8-14/h6,10-11H,2-5,7-8H2,1H3 |
| InChIKey | GEYPWSBIDRMUGE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |