C10H13NO2 — CID 126997749
2,3-dihydrofuran-5-yl(3,6-dihydro-2H-pyridin-1-yl)methanone (PubChem CID 126997749) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 2,3-dihydrofuran-5-yl(3,6-dihydro-2H-pyridin-1-yl)methanone.
| Compound Name | 2,3-dihydrofuran-5-yl(3,6-dihydro-2H-pyridin-1-yl)methanone |
|---|---|
| PubChem CID | 126997749 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2,3-dihydrofuran-5-yl(3,6-dihydro-2H-pyridin-1-yl)methanone |
| SMILES | O=C(C1=CCCO1)N1CC=CCC1 |
| InChI | InChI=1S/C10H13NO2/c12-10(9-5-4-8-13-9)11-6-2-1-3-7-11/h1-2,5H,3-4,6-8H2 |
| InChIKey | LKHFMTGPVFPJFJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|