C8H14FNO2S — CID 127000321
5-fluoro-1-propan-2-ylsulfonyl-3,6-dihydro-2H-pyridine (PubChem CID 127000321) has the molecular formula C8H14FNO2S and a molecular weight of 207.27 g/mol. Its IUPAC name is 5-fluoro-1-propan-2-ylsulfonyl-3,6-dihydro-2H-pyridine.
| Compound Name | 5-fluoro-1-propan-2-ylsulfonyl-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 127000321 |
| Molecular Formula | C8H14FNO2S |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 5-fluoro-1-propan-2-ylsulfonyl-3,6-dihydro-2H-pyridine |
| SMILES | CC(C)S(=O)(=O)N1CCC=C(F)C1 |
| InChI | InChI=1S/C8H14FNO2S/c1-7(2)13(11,12)10-5-3-4-8(9)6-10/h4,7H,3,5-6H2,1-2H3 |
| InChIKey | GYCCLXZNPCJKOB-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |