C7H16N2O3S2 — CID 127001312
2-[(1-oxo-1,4-thiazepan-4-yl)sulfonyl]ethanamine (PubChem CID 127001312) has the molecular formula C7H16N2O3S2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-[(1-oxo-1,4-thiazepan-4-yl)sulfonyl]ethanamine.
| Compound Name | 2-[(1-oxo-1,4-thiazepan-4-yl)sulfonyl]ethanamine |
|---|---|
| PubChem CID | 127001312 |
| Molecular Formula | C7H16N2O3S2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 2-[(1-oxo-1,4-thiazepan-4-yl)sulfonyl]ethanamine |
| SMILES | NCCS(=O)(=O)N1CCCS(=O)CC1 |
| InChI | InChI=1S/C7H16N2O3S2/c8-2-7-14(11,12)9-3-1-5-13(10)6-4-9/h1-8H2 |
| InChIKey | DCFMTYPDEKRSTE-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |