About ethyl-imino-oxo-(1-oxo-1,4-thiazepan-4-yl)-λ6-sulfane
ethyl-imino-oxo-(1-oxo-1,4-thiazepan-4-yl)-λ6-sulfane (PubChem CID 164648394) has the molecular formula C7H16N2O2S2
and a molecular weight of 224.35 g/mol. Its IUPAC name is ethyl-imino-oxo-(1-oxo-1,4-thiazepan-4-yl)-λ6-sulfane.
Molecular Properties
| Compound Name | ethyl-imino-oxo-(1-oxo-1,4-thiazepan-4-yl)-λ6-sulfane |
| PubChem CID | 164648394 |
| Molecular Formula | C7H16N2O2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | ethyl-imino-oxo-(1-oxo-1,4-thiazepan-4-yl)-λ6-sulfane |
| SMILES | [H]N=S(=O)(CC)N1CCCS(=O)CC1 |
| InChI | InChI=1S/C7H16N2O2S2/c1-2-13(8,11)9-4-3-6-12(10)7-5-9/h8H,2-7H2,1H3 |
| InChIKey | BXRXYPRPTGDHCY-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl-imino-oxo-(1-oxo-1,4-thiazepan-4-yl)-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-imino-oxo-(1-oxo-1,4-thiazepan-4-yl)-λ6-sulfane?
The IUPAC name of ethyl-imino-oxo-(1-oxo-1,4-thiazepan-4-yl)-λ6-sulfane (CID 164648394) is ethyl-imino-oxo-(1-oxo-1,4-thiazepan-4-yl)-λ6-sulfane.
What is the SMILES notation for ethyl-imino-oxo-(1-oxo-1,4-thiazepan-4-yl)-λ6-sulfane?
The canonical SMILES for ethyl-imino-oxo-(1-oxo-1,4-thiazepan-4-yl)-λ6-sulfane is [H]N=S(=O)(CC)N1CCCS(=O)CC1.
What is the InChIKey of ethyl-imino-oxo-(1-oxo-1,4-thiazepan-4-yl)-λ6-sulfane?
The InChIKey is BXRXYPRPTGDHCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2O2S2/c1-2-13(8,11)9-4-3-6-12(10)7-5-9/h8H,2-7H2,1H3.
What are the key properties of ethyl-imino-oxo-(1-oxo-1,4-thiazepan-4-yl)-λ6-sulfane?
ethyl-imino-oxo-(1-oxo-1,4-thiazepan-4-yl)-λ6-sulfane has a molecular weight of 224.35 g/mol, XLogP of 0.42, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-imino-oxo-(1-oxo-1,4-thiazepan-4-yl)-λ6-sulfane is sourced from PubChem (CID 164648394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).