C11H17N3O3S2 — CID 55043507
N-ethyl-4-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]pyridin-2-amine (PubChem CID 55043507) has the molecular formula C11H17N3O3S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is N-ethyl-4-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]pyridin-2-amine.
| Compound Name | N-ethyl-4-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]pyridin-2-amine |
|---|---|
| PubChem CID | 55043507 |
| Molecular Formula | C11H17N3O3S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | N-ethyl-4-[(1-oxo-1,4-thiazinan-4-yl)sulfonyl]pyridin-2-amine |
| SMILES | CCNc1cc(S(=O)(=O)N2CCS(=O)CC2)ccn1 |
| InChI | InChI=1S/C11H17N3O3S2/c1-2-12-11-9-10(3-4-13-11)19(16,17)14-5-7-18(15)8-6-14/h3-4,9H,2,5-8H2,1H3,(H,12,13) |
| InChIKey | UWLSPIRULNLYSA-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |