C18H24N4O2S — CID 113228640
4-(4-benzylpiperazin-1-yl)sulfonyl-N-ethylpyridin-2-amine (PubChem CID 113228640) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is 4-(4-benzylpiperazin-1-yl)sulfonyl-N-ethylpyridin-2-amine.
| Compound Name | 4-(4-benzylpiperazin-1-yl)sulfonyl-N-ethylpyridin-2-amine |
|---|---|
| PubChem CID | 113228640 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | 4-(4-benzylpiperazin-1-yl)sulfonyl-N-ethylpyridin-2-amine |
| SMILES | CCNc1cc(S(=O)(=O)N2CCN(Cc3ccccc3)CC2)ccn1 |
| InChI | InChI=1S/C18H24N4O2S/c1-2-19-18-14-17(8-9-20-18)25(23,24)22-12-10-21(11-13-22)15-16-6-4-3-5-7-16/h3-9,14H,2,10-13,15H2,1H3,(H,19,20) |
| InChIKey | QVJUHCZNGDTJSK-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |