C10H20N2 — CID 127004337
N,N,2-trimethylcyclohexane-1-carboximidamide (PubChem CID 127004337) has the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. Its IUPAC name is N,N,2-trimethylcyclohexane-1-carboximidamide.
| Compound Name | N,N,2-trimethylcyclohexane-1-carboximidamide |
|---|---|
| PubChem CID | 127004337 |
| Molecular Formula | C10H20N2 |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.16 |
| IUPAC Name | N,N,2-trimethylcyclohexane-1-carboximidamide |
| SMILES | [H]/N=C(/C1CCCCC1C)N(C)C |
| InChI | InChI=1S/C10H20N2/c1-8-6-4-5-7-9(8)10(11)12(2)3/h8-9,11H,4-7H2,1-3H3/b11-10- |
| InChIKey | CQVQGRTWJGJDNW-KHPPLWFESA-N |
| XLogP | 2.35 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|