C11H21NO — CID 127004590
(E)-1-(2,2-dimethylcyclopropyl)-N-[(2-methylpropan-2-yl)oxy]ethanimine (PubChem CID 127004590) has the molecular formula C11H21NO and a molecular weight of 183.29 g/mol. Its IUPAC name is (E)-1-(2,2-dimethylcyclopropyl)-N-[(2-methylpropan-2-yl)oxy]ethanimine.
| Compound Name | (E)-1-(2,2-dimethylcyclopropyl)-N-[(2-methylpropan-2-yl)oxy]ethanimine |
|---|---|
| PubChem CID | 127004590 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | (E)-1-(2,2-dimethylcyclopropyl)-N-[(2-methylpropan-2-yl)oxy]ethanimine |
| SMILES | C/C(=N\OC(C)(C)C)C1CC1(C)C |
| InChI | InChI=1S/C11H21NO/c1-8(9-7-11(9,5)6)12-13-10(2,3)4/h9H,7H2,1-6H3/b12-8+ |
| InChIKey | MCNDECZRXKCWCQ-XYOKQWHBSA-N |
| XLogP | 3.22 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|