C11H21N3O — CID 5405593
[(Z)-1-[(1S,2S)-2-tert-butyl-2-methylcyclopropyl]ethylideneamino]urea (PubChem CID 5405593) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is [(Z)-1-[(1S,2S)-2-tert-butyl-2-methylcyclopropyl]ethylideneamino]urea.
| Compound Name | [(Z)-1-[(1S,2S)-2-tert-butyl-2-methylcyclopropyl]ethylideneamino]urea |
|---|---|
| PubChem CID | 5405593 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | [(Z)-1-[(1S,2S)-2-tert-butyl-2-methylcyclopropyl]ethylideneamino]urea |
| SMILES | C/C(=N/NC(N)=O)[C@H]1C[C@]1(C)C(C)(C)C |
| InChI | InChI=1S/C11H21N3O/c1-7(13-14-9(12)15)8-6-11(8,5)10(2,3)4/h8H,6H2,1-5H3,(H3,12,14,15)/b13-7-/t8-,11+/m1/s1 |
| InChIKey | CKQDLWSKFIVAEJ-ZCCXGGGGSA-N |
| XLogP | 2.10 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|