C10H17N3O3 — CID 6341386
[(Z)-1-[(3R)-5,5-dimethyl-2-oxooxolan-3-yl]propan-2-ylideneamino]urea (PubChem CID 6341386) has the molecular formula C10H17N3O3 and a molecular weight of 227.26 g/mol. Its IUPAC name is [(Z)-1-[(3R)-5,5-dimethyl-2-oxooxolan-3-yl]propan-2-ylideneamino]urea.
| Compound Name | [(Z)-1-[(3R)-5,5-dimethyl-2-oxooxolan-3-yl]propan-2-ylideneamino]urea |
|---|---|
| PubChem CID | 6341386 |
| Molecular Formula | C10H17N3O3 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | [(Z)-1-[(3R)-5,5-dimethyl-2-oxooxolan-3-yl]propan-2-ylideneamino]urea |
| SMILES | C/C(C[C@@H]1CC(C)(C)OC1=O)=N/NC(N)=O |
| InChI | InChI=1S/C10H17N3O3/c1-6(12-13-9(11)15)4-7-5-10(2,3)16-8(7)14/h7H,4-5H2,1-3H3,(H3,11,13,15)/b12-6-/t7-/m1/s1 |
| InChIKey | UBABVEFNJSJLQX-WCLCAVJRSA-N |
| XLogP | 0.76 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|