C18H21N3O2S — CID 5423172
(3R)-5,5-dimethyl-3-[(2E)-2-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]propyl]oxolan-2-one (PubChem CID 5423172) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is (3R)-5,5-dimethyl-3-[(2E)-2-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]propyl]oxolan-2-one.
| Compound Name | (3R)-5,5-dimethyl-3-[(2E)-2-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]propyl]oxolan-2-one |
|---|---|
| PubChem CID | 5423172 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | (3R)-5,5-dimethyl-3-[(2E)-2-[(4-phenyl-1,3-thiazol-2-yl)hydrazinylidene]propyl]oxolan-2-one |
| SMILES | C/C(C[C@@H]1CC(C)(C)OC1=O)=N\Nc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C18H21N3O2S/c1-12(9-14-10-18(2,3)23-16(14)22)20-21-17-19-15(11-24-17)13-7-5-4-6-8-13/h4-8,11,14H,9-10H2,1-3H3,(H,19,21)/b20-12+/t14-/m1/s1 |
| InChIKey | SQMFKXYGJMHGHJ-MQMKENTISA-N |
| XLogP | 4.33 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|