C24H24N4S2 — CID 172994919
N-[1-(2,6-dimethyl-4-methylsulfanylquinolin-3-yl)propan-2-ylideneamino]-4-phenyl-1,3-thiazol-2-amine (PubChem CID 172994919) has the molecular formula C24H24N4S2 and a molecular weight of 432.62 g/mol. Its IUPAC name is N-[1-(2,6-dimethyl-4-methylsulfanylquinolin-3-yl)propan-2-ylideneamino]-4-phenyl-1,3-thiazol-2-amine.
| Compound Name | N-[1-(2,6-dimethyl-4-methylsulfanylquinolin-3-yl)propan-2-ylideneamino]-4-phenyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 172994919 |
| Molecular Formula | C24H24N4S2 |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | N-[1-(2,6-dimethyl-4-methylsulfanylquinolin-3-yl)propan-2-ylideneamino]-4-phenyl-1,3-thiazol-2-amine |
| SMILES | CSc1c(CC(C)=NNc2nc(-c3ccccc3)cs2)c(C)nc2ccc(C)cc12 |
| InChI | InChI=1S/C24H24N4S2/c1-15-10-11-21-20(12-15)23(29-4)19(17(3)25-21)13-16(2)27-28-24-26-22(14-30-24)18-8-6-5-7-9-18/h5-12,14H,13H2,1-4H3,(H,26,28) |
| InChIKey | CFEMSQPHJGBJMO-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|