C10H17N3O2S — CID 7006181
[1-[(3S)-5,5-dimethyl-2-oxooxolan-3-yl]prop-1-en-2-ylamino]thiourea (PubChem CID 7006181) has the molecular formula C10H17N3O2S and a molecular weight of 243.33 g/mol. Its IUPAC name is [1-[(3S)-5,5-dimethyl-2-oxooxolan-3-yl]prop-1-en-2-ylamino]thiourea.
| Compound Name | [1-[(3S)-5,5-dimethyl-2-oxooxolan-3-yl]prop-1-en-2-ylamino]thiourea |
|---|---|
| PubChem CID | 7006181 |
| Molecular Formula | C10H17N3O2S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | [1-[(3S)-5,5-dimethyl-2-oxooxolan-3-yl]prop-1-en-2-ylamino]thiourea |
| SMILES | CC(=C[C@@H]1CC(C)(C)OC1=O)NNC(N)=S |
| InChI | InChI=1S/C10H17N3O2S/c1-6(12-13-9(11)16)4-7-5-10(2,3)15-8(7)14/h4,7,12H,5H2,1-3H3,(H3,11,13,16)/t7-/m1/s1 |
| InChIKey | QCDZDRCPSVDNQL-SSDOTTSWSA-N |
| XLogP | 0.57 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|