C10H17N3S — CID 2132294
[[(1Z)-1-[(1R,4S)-2-bicyclo[2.2.1]heptanylidene]ethyl]amino]thiourea (PubChem CID 2132294) has the molecular formula C10H17N3S and a molecular weight of 211.33 g/mol. Its IUPAC name is [[(1Z)-1-[(1R,4S)-2-bicyclo[2.2.1]heptanylidene]ethyl]amino]thiourea.
| Compound Name | [[(1Z)-1-[(1R,4S)-2-bicyclo[2.2.1]heptanylidene]ethyl]amino]thiourea |
|---|---|
| PubChem CID | 2132294 |
| Molecular Formula | C10H17N3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | [[(1Z)-1-[(1R,4S)-2-bicyclo[2.2.1]heptanylidene]ethyl]amino]thiourea |
| SMILES | C/C(NNC(N)=S)=C1\C[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C10H17N3S/c1-6(12-13-10(11)14)9-5-7-2-3-8(9)4-7/h7-8,12H,2-5H2,1H3,(H3,11,13,14)/b9-6-/t7-,8+/m0/s1 |
| InChIKey | AEAHVYGKVZDZTB-GCICIJSESA-N |
| XLogP | 1.42 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|