C8H15N3OS — CID 107185420
[(2-methylcyclopentanecarbonyl)amino]thiourea (PubChem CID 107185420) has the molecular formula C8H15N3OS and a molecular weight of 201.29 g/mol. Its IUPAC name is [(2-methylcyclopentanecarbonyl)amino]thiourea.
| Compound Name | [(2-methylcyclopentanecarbonyl)amino]thiourea |
|---|---|
| PubChem CID | 107185420 |
| Molecular Formula | C8H15N3OS |
| Molecular Weight | 201.29 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | [(2-methylcyclopentanecarbonyl)amino]thiourea |
| SMILES | CC1CCCC1C(=O)NNC(N)=S |
| InChI | InChI=1S/C8H15N3OS/c1-5-3-2-4-6(5)7(12)10-11-8(9)13/h5-6H,2-4H2,1H3,(H,10,12)(H3,9,11,13) |
| InChIKey | UIINRGAVBPLHCM-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.29 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|