C8H16N4OS — CID 45097493
[(1-methylpiperidine-4-carbonyl)amino]thiourea (PubChem CID 45097493) has the molecular formula C8H16N4OS and a molecular weight of 216.31 g/mol. Its IUPAC name is [(1-methylpiperidine-4-carbonyl)amino]thiourea.
| Compound Name | [(1-methylpiperidine-4-carbonyl)amino]thiourea |
|---|---|
| PubChem CID | 45097493 |
| Molecular Formula | C8H16N4OS |
| Molecular Weight | 216.31 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | [(1-methylpiperidine-4-carbonyl)amino]thiourea |
| SMILES | CN1CCC(C(=O)NNC(N)=S)CC1 |
| InChI | InChI=1S/C8H16N4OS/c1-12-4-2-6(3-5-12)7(13)10-11-8(9)14/h6H,2-5H2,1H3,(H,10,13)(H3,9,11,14) |
| InChIKey | FRRBFDTWIDJHNP-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.31 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|