C11H18N4OS — CID 168979130
[[1-[(1R)-cyclobut-2-en-1-yl]piperidine-4-carbonyl]amino]thiourea (PubChem CID 168979130) has the molecular formula C11H18N4OS and a molecular weight of 254.36 g/mol. Its IUPAC name is [[1-[(1R)-cyclobut-2-en-1-yl]piperidine-4-carbonyl]amino]thiourea.
| Compound Name | [[1-[(1R)-cyclobut-2-en-1-yl]piperidine-4-carbonyl]amino]thiourea |
|---|---|
| PubChem CID | 168979130 |
| Molecular Formula | C11H18N4OS |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | [[1-[(1R)-cyclobut-2-en-1-yl]piperidine-4-carbonyl]amino]thiourea |
| SMILES | NC(=S)NNC(=O)C1CCN([C@H]2C=CC2)CC1 |
| InChI | InChI=1S/C11H18N4OS/c12-11(17)14-13-10(16)8-4-6-15(7-5-8)9-2-1-3-9/h1-2,8-9H,3-7H2,(H,13,16)(H3,12,14,17)/t9-/m0/s1 |
| InChIKey | FJIRKSHCVKPHHW-VIFPVBQESA-N |
| XLogP | -0.11 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|