About [(Z)-1-[(2S,4S)-5-oxo-4-pentyloxolan-2-yl]ethylideneamino]urea
[(Z)-1-[(2S,4S)-5-oxo-4-pentyloxolan-2-yl]ethylideneamino]urea (PubChem CID 7336108) has the molecular formula C12H21N3O3
and a molecular weight of 255.32 g/mol. Its IUPAC name is [(Z)-1-[(2S,4S)-5-oxo-4-pentyloxolan-2-yl]ethylideneamino]urea.
Molecular Properties
| Compound Name | [(Z)-1-[(2S,4S)-5-oxo-4-pentyloxolan-2-yl]ethylideneamino]urea |
| PubChem CID | 7336108 |
| Molecular Formula | C12H21N3O3 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | [(Z)-1-[(2S,4S)-5-oxo-4-pentyloxolan-2-yl]ethylideneamino]urea |
| SMILES | CCCCC[C@H]1C[C@@H](/C(C)=N\NC(N)=O)OC1=O |
| InChI | InChI=1S/C12H21N3O3/c1-3-4-5-6-9-7-10(18-11(9)16)8(2)14-15-12(13)17/h9-10H,3-7H2,1-2H3,(H3,13,15,17)/b14-8-/t9-,10-/m0/s1 |
| InChIKey | RLTYDGPKBJKGAE-VMKDRBRPSA-N |
| XLogP | 1.54 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1-[(2S,4S)-5-oxo-4-pentyloxolan-2-yl]ethylideneamino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1-[(2S,4S)-5-oxo-4-pentyloxolan-2-yl]ethylideneamino]urea?
The IUPAC name of [(Z)-1-[(2S,4S)-5-oxo-4-pentyloxolan-2-yl]ethylideneamino]urea (CID 7336108) is [(Z)-1-[(2S,4S)-5-oxo-4-pentyloxolan-2-yl]ethylideneamino]urea.
What is the SMILES notation for [(Z)-1-[(2S,4S)-5-oxo-4-pentyloxolan-2-yl]ethylideneamino]urea?
The canonical SMILES for [(Z)-1-[(2S,4S)-5-oxo-4-pentyloxolan-2-yl]ethylideneamino]urea is CCCCC[C@H]1C[C@@H](/C(C)=N\NC(N)=O)OC1=O.
What is the InChIKey of [(Z)-1-[(2S,4S)-5-oxo-4-pentyloxolan-2-yl]ethylideneamino]urea?
The InChIKey is RLTYDGPKBJKGAE-VMKDRBRPSA-N. The full InChI is InChI=1S/C12H21N3O3/c1-3-4-5-6-9-7-10(18-11(9)16)8(2)14-15-12(13)17/h9-10H,3-7H2,1-2H3,(H3,13,15,17)/b14-8-/t9-,10-/m0/s1.
What are the key properties of [(Z)-1-[(2S,4S)-5-oxo-4-pentyloxolan-2-yl]ethylideneamino]urea?
[(Z)-1-[(2S,4S)-5-oxo-4-pentyloxolan-2-yl]ethylideneamino]urea has a molecular weight of 255.32 g/mol, XLogP of 1.54, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1-[(2S,4S)-5-oxo-4-pentyloxolan-2-yl]ethylideneamino]urea is sourced from PubChem (CID 7336108), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).