C13H24N4O4 — CID 93488725
[(Z)-1-[(1S,2R,5R)-2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl]ethylideneamino]urea (PubChem CID 93488725) has the molecular formula C13H24N4O4 and a molecular weight of 300.36 g/mol. Its IUPAC name is [(Z)-1-[(1S,2R,5R)-2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl]ethylideneamino]urea.
| Compound Name | [(Z)-1-[(1S,2R,5R)-2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl]ethylideneamino]urea |
|---|---|
| PubChem CID | 93488725 |
| Molecular Formula | C13H24N4O4 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | [(Z)-1-[(1S,2R,5R)-2-hydroxy-2-methyl-5-nitro-5-propylcyclohexyl]ethylideneamino]urea |
| SMILES | CCC[C@@]1([N+](=O)[O-])CC[C@@](C)(O)[C@H](/C(C)=N\NC(N)=O)C1 |
| InChI | InChI=1S/C13H24N4O4/c1-4-5-13(17(20)21)7-6-12(3,19)10(8-13)9(2)15-16-11(14)18/h10,19H,4-8H2,1-3H3,(H3,14,16,18)/b15-9-/t10-,12+,13+/m0/s1 |
| InChIKey | ZULOSMOAFIZNFR-VFRIPEGASA-N |
| XLogP | 1.40 |
| TPSA | 130.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|