C14H27N3O — CID 542078
[1-(3-ethyl-2,2-dipropylcyclopropyl)ethylideneamino]urea (PubChem CID 542078) has the molecular formula C14H27N3O and a molecular weight of 253.39 g/mol. Its IUPAC name is [1-(3-ethyl-2,2-dipropylcyclopropyl)ethylideneamino]urea.
| Compound Name | [1-(3-ethyl-2,2-dipropylcyclopropyl)ethylideneamino]urea |
|---|---|
| PubChem CID | 542078 |
| Molecular Formula | C14H27N3O |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.22 |
| IUPAC Name | [1-(3-ethyl-2,2-dipropylcyclopropyl)ethylideneamino]urea |
| SMILES | CCCC1(CCC)C(CC)C1C(C)=NNC(N)=O |
| InChI | InChI=1S/C14H27N3O/c1-5-8-14(9-6-2)11(7-3)12(14)10(4)16-17-13(15)18/h11-12H,5-9H2,1-4H3,(H3,15,17,18) |
| InChIKey | KLGBWJHOHXLSPX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|